About 2-ethylidene-5-methyl-1,3-oxazolidine
2-ethylidene-5-methyl-1,3-oxazolidine (PubChem CID 174906636) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-ethylidene-5-methyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-ethylidene-5-methyl-1,3-oxazolidine |
| PubChem CID | 174906636 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2-ethylidene-5-methyl-1,3-oxazolidine |
| SMILES | CC=C1NCC(C)O1 |
| InChI | InChI=1S/C6H11NO/c1-3-6-7-4-5(2)8-6/h3,5,7H,4H2,1-2H3 |
| InChIKey | QCMBSOGHCDKHHC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylidene-5-methyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylidene-5-methyl-1,3-oxazolidine?
The IUPAC name of 2-ethylidene-5-methyl-1,3-oxazolidine (CID 174906636) is 2-ethylidene-5-methyl-1,3-oxazolidine.
What is the SMILES notation for 2-ethylidene-5-methyl-1,3-oxazolidine?
The canonical SMILES for 2-ethylidene-5-methyl-1,3-oxazolidine is CC=C1NCC(C)O1.
What is the InChIKey of 2-ethylidene-5-methyl-1,3-oxazolidine?
The InChIKey is QCMBSOGHCDKHHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-3-6-7-4-5(2)8-6/h3,5,7H,4H2,1-2H3.
What are the key properties of 2-ethylidene-5-methyl-1,3-oxazolidine?
2-ethylidene-5-methyl-1,3-oxazolidine has a molecular weight of 113.16 g/mol, XLogP of 0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylidene-5-methyl-1,3-oxazolidine is sourced from PubChem (CID 174906636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).