About ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine
ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine (PubChem CID 174906816) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine.
Molecular Properties
| Compound Name | ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine |
| PubChem CID | 174906816 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine |
| SMILES | CCO.COc1cc(/N=C/c2ccccc2)ccn1 |
| InChI | InChI=1S/C13H12N2O.C2H6O/c1-16-13-9-12(7-8-14-13)15-10-11-5-3-2-4-6-11;1-2-3/h2-10H,1H3;3H,2H2,1H3/b15-10+; |
| InChIKey | LQLRQXUTWRLXCB-GYVLLFFHSA-N |
| XLogP | 2.84 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine?
The IUPAC name of ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine (CID 174906816) is ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine.
What is the SMILES notation for ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine?
The canonical SMILES for ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine is CCO.COc1cc(/N=C/c2ccccc2)ccn1.
What is the InChIKey of ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine?
The InChIKey is LQLRQXUTWRLXCB-GYVLLFFHSA-N. The full InChI is InChI=1S/C13H12N2O.C2H6O/c1-16-13-9-12(7-8-14-13)15-10-11-5-3-2-4-6-11;1-2-3/h2-10H,1H3;3H,2H2,1H3/b15-10+;.
What are the key properties of ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine?
ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine has a molecular weight of 258.32 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;N-(2-methoxy-4-pyridinyl)-1-phenylmethanimine is sourced from PubChem (CID 174906816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).