About anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane
anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane (PubChem CID 174907101) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane.
Molecular Properties
| Compound Name | anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
| PubChem CID | 174907101 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
| SMILES | CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1.COc1ccccc1 |
| InChI | InChI=1S/C12H18N2O2.C7H8O/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15;1-8-7-5-3-2-4-6-7/h10H,4-7H2,1-3H3;2-6H,1H3 |
| InChIKey | VDOGKJWABODWNE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane?
The IUPAC name of anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane (CID 174907101) is anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane.
What is the SMILES notation for anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane?
The canonical SMILES for anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane is CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1.COc1ccccc1.
What is the InChIKey of anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane?
The InChIKey is VDOGKJWABODWNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2.C7H8O/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15;1-8-7-5-3-2-4-6-7/h10H,4-7H2,1-3H3;2-6H,1H3.
What are the key properties of anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane?
anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane has a molecular weight of 330.43 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane is sourced from PubChem (CID 174907101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).