About 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride
2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride (PubChem CID 174907794) has the molecular formula C8H17ClN2O2
and a molecular weight of 208.69 g/mol. Its IUPAC name is 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride |
| PubChem CID | 174907794 |
| Molecular Formula | C8H17ClN2O2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride |
| SMILES | Cl.OC1(C2CCNCC2)NCCO1 |
| InChI | InChI=1S/C8H16N2O2.ClH/c11-8(10-5-6-12-8)7-1-3-9-4-2-7;/h7,9-11H,1-6H2;1H |
| InChIKey | LTGPFWMZMFUUJP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride?
The IUPAC name of 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride (CID 174907794) is 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride.
What is the SMILES notation for 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride?
The canonical SMILES for 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride is Cl.OC1(C2CCNCC2)NCCO1.
What is the InChIKey of 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride?
The InChIKey is LTGPFWMZMFUUJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2.ClH/c11-8(10-5-6-12-8)7-1-3-9-4-2-7;/h7,9-11H,1-6H2;1H.
What are the key properties of 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride?
2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride has a molecular weight of 208.69 g/mol, XLogP of -0.33, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-yl-1,3-oxazolidin-2-ol;hydrochloride is sourced from PubChem (CID 174907794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).