C20H28O5 — CID 174908433
methyl 2-prop-2-enoxyhexa-2,5-dienoate;prop-2-enyl 2-methylhexa-2,5-dienoate (PubChem CID 174908433) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is methyl 2-prop-2-enoxyhexa-2,5-dienoate;prop-2-enyl 2-methylhexa-2,5-dienoate.
| Compound Name | methyl 2-prop-2-enoxyhexa-2,5-dienoate;prop-2-enyl 2-methylhexa-2,5-dienoate |
|---|---|
| PubChem CID | 174908433 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | methyl 2-prop-2-enoxyhexa-2,5-dienoate;prop-2-enyl 2-methylhexa-2,5-dienoate |
| SMILES | C=CCC=C(C)C(=O)OCC=C.C=CCC=C(OCC=C)C(=O)OC |
| InChI | InChI=1S/C10H14O3.C10H14O2/c1-4-6-7-9(10(11)12-3)13-8-5-2;1-4-6-7-9(3)10(11)12-8-5-2/h4-5,7H,1-2,6,8H2,3H3;4-5,7H,1-2,6,8H2,3H3 |
| InChIKey | SELPGXPCIBUQJK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|