About [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate
[1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 174908487) has the molecular formula C15H25N3O3S
and a molecular weight of 327.45 g/mol. Its IUPAC name is [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate |
| PubChem CID | 174908487 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCN(Cc2ncc(CO)s2)CC1 |
| InChI | InChI=1S/C15H25N3O3S/c1-15(2,3)17-14(20)21-11-4-6-18(7-5-11)9-13-16-8-12(10-19)22-13/h8,11,19H,4-7,9-10H2,1-3H3,(H,17,20) |
| InChIKey | BHUUTCVXFBADMW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate?
The IUPAC name of [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate (CID 174908487) is [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate.
What is the SMILES notation for [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate?
The canonical SMILES for [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate is CC(C)(C)NC(=O)OC1CCN(Cc2ncc(CO)s2)CC1.
What is the InChIKey of [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate?
The InChIKey is BHUUTCVXFBADMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O3S/c1-15(2,3)17-14(20)21-11-4-6-18(7-5-11)9-13-16-8-12(10-19)22-13/h8,11,19H,4-7,9-10H2,1-3H3,(H,17,20).
What are the key properties of [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate?
[1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate has a molecular weight of 327.45 g/mol, XLogP of 2.12, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[5-(hydroxymethyl)-1,3-thiazol-2-yl]methyl]piperidin-4-yl] N-tert-butylcarbamate is sourced from PubChem (CID 174908487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).