C16H26N4O4 — CID 174908772
2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoic acid;urea (PubChem CID 174908772) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoic acid;urea.
| Compound Name | 2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoic acid;urea |
|---|---|
| PubChem CID | 174908772 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-[(2-amino-4-methylpentanoyl)amino]-3-phenylpropanoic acid;urea |
| SMILES | CC(C)CC(N)C(=O)NC(Cc1ccccc1)C(=O)O.NC(N)=O |
| InChI | InChI=1S/C15H22N2O3.CH4N2O/c1-10(2)8-12(16)14(18)17-13(15(19)20)9-11-6-4-3-5-7-11;2-1(3)4/h3-7,10,12-13H,8-9,16H2,1-2H3,(H,17,18)(H,19,20);(H4,2,3,4) |
| InChIKey | CPFZMTCURJZTSH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 161.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |