About 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide
4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide (PubChem CID 174908867) has the molecular formula C10H19N5O
and a molecular weight of 225.30 g/mol. Its IUPAC name is 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide.
Molecular Properties
| Compound Name | 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide |
| PubChem CID | 174908867 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide |
| SMILES | Cc1cn[nH]c1C.NC(=O)C1CNCCN1 |
| InChI | InChI=1S/C5H11N3O.C5H8N2/c6-5(9)4-3-7-1-2-8-4;1-4-3-6-7-5(4)2/h4,7-8H,1-3H2,(H2,6,9);3H,1-2H3,(H,6,7) |
| InChIKey | GIKJKLAHMASHIU-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide?
The IUPAC name of 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide (CID 174908867) is 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide.
What is the SMILES notation for 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide?
The canonical SMILES for 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide is Cc1cn[nH]c1C.NC(=O)C1CNCCN1.
What is the InChIKey of 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide?
The InChIKey is GIKJKLAHMASHIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O.C5H8N2/c6-5(9)4-3-7-1-2-8-4;1-4-3-6-7-5(4)2/h4,7-8H,1-3H2,(H2,6,9);3H,1-2H3,(H,6,7).
What are the key properties of 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide?
4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide has a molecular weight of 225.30 g/mol, XLogP of -0.94, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1H-pyrazole;piperazine-2-carboxamide is sourced from PubChem (CID 174908867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).