About N,N-dimethylmethanamine;phosphane;trihydrochloride
N,N-dimethylmethanamine;phosphane;trihydrochloride (PubChem CID 174909173) has the molecular formula C3H15Cl3NP
and a molecular weight of 202.49 g/mol. Its IUPAC name is N,N-dimethylmethanamine;phosphane;trihydrochloride.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;phosphane;trihydrochloride |
| PubChem CID | 174909173 |
| Molecular Formula | C3H15Cl3NP |
| Molecular Weight | 202.49 g/mol |
| Exact Mass | 201.00 |
| IUPAC Name | N,N-dimethylmethanamine;phosphane;trihydrochloride |
| SMILES | CN(C)C.Cl.Cl.Cl.P |
| InChI | InChI=1S/C3H9N.3ClH.H3P/c1-4(2)3;;;;/h1-3H3;3*1H;1H3 |
| InChIKey | OTEOUJZTPAUQEF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;phosphane;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;phosphane;trihydrochloride?
The IUPAC name of N,N-dimethylmethanamine;phosphane;trihydrochloride (CID 174909173) is N,N-dimethylmethanamine;phosphane;trihydrochloride.
What is the SMILES notation for N,N-dimethylmethanamine;phosphane;trihydrochloride?
The canonical SMILES for N,N-dimethylmethanamine;phosphane;trihydrochloride is CN(C)C.Cl.Cl.Cl.P.
What is the InChIKey of N,N-dimethylmethanamine;phosphane;trihydrochloride?
The InChIKey is OTEOUJZTPAUQEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.3ClH.H3P/c1-4(2)3;;;;/h1-3H3;3*1H;1H3.
What are the key properties of N,N-dimethylmethanamine;phosphane;trihydrochloride?
N,N-dimethylmethanamine;phosphane;trihydrochloride has a molecular weight of 202.49 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;phosphane;trihydrochloride is sourced from PubChem (CID 174909173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).