C18H25NO2 — CID 174909328
formic acid;(1S)-1-[(4-methylphenyl)methyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline (PubChem CID 174909328) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is formic acid;(1S)-1-[(4-methylphenyl)methyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline.
| Compound Name | formic acid;(1S)-1-[(4-methylphenyl)methyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline |
|---|---|
| PubChem CID | 174909328 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | formic acid;(1S)-1-[(4-methylphenyl)methyl]-1,2,3,4,5,6,7,8-octahydroisoquinoline |
| SMILES | Cc1ccc(C[C@@H]2NCCC3=C2CCCC3)cc1.O=CO |
| InChI | InChI=1S/C17H23N.CH2O2/c1-13-6-8-14(9-7-13)12-17-16-5-3-2-4-15(16)10-11-18-17;2-1-3/h6-9,17-18H,2-5,10-12H2,1H3;1H,(H,2,3)/t17-;/m0./s1 |
| InChIKey | CHISRHWUWPVOPZ-LMOVPXPDSA-N |
| XLogP | 3.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|