C18H8Cl6O9 — CID 174909586
benzene-1,2,4-tricarboxylic acid;1,7,8,9,10,10-hexachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 174909586) has the molecular formula C18H8Cl6O9 and a molecular weight of 580.97 g/mol. Its IUPAC name is benzene-1,2,4-tricarboxylic acid;1,7,8,9,10,10-hexachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | benzene-1,2,4-tricarboxylic acid;1,7,8,9,10,10-hexachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 174909586 |
| Molecular Formula | C18H8Cl6O9 |
| Molecular Weight | 580.97 g/mol |
| Exact Mass | 577.83 |
| IUPAC Name | benzene-1,2,4-tricarboxylic acid;1,7,8,9,10,10-hexachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1.O=C1OC(=O)C2C1C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C9H2Cl6O3.C9H6O6/c10-3-4(11)8(13)2-1(5(16)18-6(2)17)7(3,12)9(8,14)15;10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h1-2H;1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | BUSWQBDLQYEKHG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.97 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|