About [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate
[(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate (PubChem CID 174909899) has the molecular formula C14H14Cl2N2O5
and a molecular weight of 361.18 g/mol. Its IUPAC name is [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate |
| PubChem CID | 174909899 |
| Molecular Formula | C14H14Cl2N2O5 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)ON(C(=O)Nc1cc(Cl)cc(Cl)c1)C(=O)OCC |
| InChI | InChI=1S/C14H14Cl2N2O5/c1-4-22-14(21)18(23-12(19)8(2)3)13(20)17-11-6-9(15)5-10(16)7-11/h5-7H,2,4H2,1,3H3,(H,17,20) |
| InChIKey | LRRSAZJHJZBYLF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate?
The IUPAC name of [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate (CID 174909899) is [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate.
What is the SMILES notation for [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate?
The canonical SMILES for [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate is C=C(C)C(=O)ON(C(=O)Nc1cc(Cl)cc(Cl)c1)C(=O)OCC.
What is the InChIKey of [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate?
The InChIKey is LRRSAZJHJZBYLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O5/c1-4-22-14(21)18(23-12(19)8(2)3)13(20)17-11-6-9(15)5-10(16)7-11/h5-7H,2,4H2,1,3H3,(H,17,20).
What are the key properties of [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate?
[(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate has a molecular weight of 361.18 g/mol, XLogP of 4.02, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,5-dichlorophenyl)carbamoyl-ethoxycarbonylamino] 2-methylprop-2-enoate is sourced from PubChem (CID 174909899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).