C7HF12NO — CID 174910372
2,2,3,3-tetrafluoro-3-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanal (PubChem CID 174910372) has the molecular formula C7HF12NO and a molecular weight of 343.07 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanal.
| Compound Name | 2,2,3,3-tetrafluoro-3-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanal |
|---|---|
| PubChem CID | 174910372 |
| Molecular Formula | C7HF12NO |
| Molecular Weight | 343.07 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 2,2,3,3-tetrafluoro-3-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanal |
| SMILES | O=CC(F)(F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7HF12NO/c8-2(9,1-21)5(14,15)20-6(16,17)3(10,11)4(12,13)7(20,18)19/h1H |
| InChIKey | VUHURUKGTXOSNU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.07 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|