About propan-1-amine;tetrachlorohafnium;titanium
propan-1-amine;tetrachlorohafnium;titanium (PubChem CID 174911130) has the molecular formula C3H9Cl4HfNTi
and a molecular weight of 427.28 g/mol. Its IUPAC name is propan-1-amine;tetrachlorohafnium;titanium.
Molecular Properties
| Compound Name | propan-1-amine;tetrachlorohafnium;titanium |
| PubChem CID | 174911130 |
| Molecular Formula | C3H9Cl4HfNTi |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.84 |
| IUPAC Name | propan-1-amine;tetrachlorohafnium;titanium |
| SMILES | CCCN.Cl[Hf](Cl)(Cl)Cl.[Ti] |
| InChI | InChI=1S/C3H9N.4ClH.Hf.Ti/c1-2-3-4;;;;;;/h2-4H2,1H3;4*1H;;/q;;;;;+4;/p-4 |
| InChIKey | CLRFMPAKRAZULG-UHFFFAOYSA-J |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-1-amine;tetrachlorohafnium;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-1-amine;tetrachlorohafnium;titanium?
The IUPAC name of propan-1-amine;tetrachlorohafnium;titanium (CID 174911130) is propan-1-amine;tetrachlorohafnium;titanium.
What is the SMILES notation for propan-1-amine;tetrachlorohafnium;titanium?
The canonical SMILES for propan-1-amine;tetrachlorohafnium;titanium is CCCN.Cl[Hf](Cl)(Cl)Cl.[Ti].
What is the InChIKey of propan-1-amine;tetrachlorohafnium;titanium?
The InChIKey is CLRFMPAKRAZULG-UHFFFAOYSA-J. The full InChI is InChI=1S/C3H9N.4ClH.Hf.Ti/c1-2-3-4;;;;;;/h2-4H2,1H3;4*1H;;/q;;;;;+4;/p-4.
What are the key properties of propan-1-amine;tetrachlorohafnium;titanium?
propan-1-amine;tetrachlorohafnium;titanium has a molecular weight of 427.28 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-1-amine;tetrachlorohafnium;titanium is sourced from PubChem (CID 174911130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).