About arsane;1-(2-hydroxyethyl)pyrrolidin-2-one
arsane;1-(2-hydroxyethyl)pyrrolidin-2-one (PubChem CID 174911308) has the molecular formula C6H14AsNO2
and a molecular weight of 207.10 g/mol. Its IUPAC name is arsane;1-(2-hydroxyethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | arsane;1-(2-hydroxyethyl)pyrrolidin-2-one |
| PubChem CID | 174911308 |
| Molecular Formula | C6H14AsNO2 |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | arsane;1-(2-hydroxyethyl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCO.[AsH3] |
| InChI | InChI=1S/C6H11NO2.AsH3/c8-5-4-7-3-1-2-6(7)9;/h8H,1-5H2;1H3 |
| InChIKey | UAJDWKDIJZUMCM-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze arsane;1-(2-hydroxyethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of arsane;1-(2-hydroxyethyl)pyrrolidin-2-one?
The IUPAC name of arsane;1-(2-hydroxyethyl)pyrrolidin-2-one (CID 174911308) is arsane;1-(2-hydroxyethyl)pyrrolidin-2-one.
What is the SMILES notation for arsane;1-(2-hydroxyethyl)pyrrolidin-2-one?
The canonical SMILES for arsane;1-(2-hydroxyethyl)pyrrolidin-2-one is O=C1CCCN1CCO.[AsH3].
What is the InChIKey of arsane;1-(2-hydroxyethyl)pyrrolidin-2-one?
The InChIKey is UAJDWKDIJZUMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.AsH3/c8-5-4-7-3-1-2-6(7)9;/h8H,1-5H2;1H3.
What are the key properties of arsane;1-(2-hydroxyethyl)pyrrolidin-2-one?
arsane;1-(2-hydroxyethyl)pyrrolidin-2-one has a molecular weight of 207.10 g/mol, XLogP of -1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for arsane;1-(2-hydroxyethyl)pyrrolidin-2-one is sourced from PubChem (CID 174911308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).