About 1-fluoropyrrolidin-2-ol
1-fluoropyrrolidin-2-ol (PubChem CID 174911437) has the molecular formula C4H8FNO
and a molecular weight of 105.11 g/mol. Its IUPAC name is 1-fluoropyrrolidin-2-ol.
Molecular Properties
| Compound Name | 1-fluoropyrrolidin-2-ol |
| PubChem CID | 174911437 |
| Molecular Formula | C4H8FNO |
| Molecular Weight | 105.11 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 1-fluoropyrrolidin-2-ol |
| SMILES | OC1CCCN1F |
| InChI | InChI=1S/C4H8FNO/c5-6-3-1-2-4(6)7/h4,7H,1-3H2 |
| InChIKey | FGZLEBLFXRJHEJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.11 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoropyrrolidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoropyrrolidin-2-ol?
The IUPAC name of 1-fluoropyrrolidin-2-ol (CID 174911437) is 1-fluoropyrrolidin-2-ol.
What is the SMILES notation for 1-fluoropyrrolidin-2-ol?
The canonical SMILES for 1-fluoropyrrolidin-2-ol is OC1CCCN1F.
What is the InChIKey of 1-fluoropyrrolidin-2-ol?
The InChIKey is FGZLEBLFXRJHEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8FNO/c5-6-3-1-2-4(6)7/h4,7H,1-3H2.
What are the key properties of 1-fluoropyrrolidin-2-ol?
1-fluoropyrrolidin-2-ol has a molecular weight of 105.11 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoropyrrolidin-2-ol is sourced from PubChem (CID 174911437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).