About 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine
8-propan-2-yl-5,6-dihydro-1,7-naphthyridine (PubChem CID 174911896) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine.
Molecular Properties
| Compound Name | 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine |
| PubChem CID | 174911896 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine |
| SMILES | CC(C)C1=NCCc2cccnc21 |
| InChI | InChI=1S/C11H14N2/c1-8(2)10-11-9(5-7-13-10)4-3-6-12-11/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | XKPFFVAFQJKXJT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine?
The IUPAC name of 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine (CID 174911896) is 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine.
What is the SMILES notation for 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine?
The canonical SMILES for 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine is CC(C)C1=NCCc2cccnc21.
What is the InChIKey of 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine?
The InChIKey is XKPFFVAFQJKXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-8(2)10-11-9(5-7-13-10)4-3-6-12-11/h3-4,6,8H,5,7H2,1-2H3.
What are the key properties of 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine?
8-propan-2-yl-5,6-dihydro-1,7-naphthyridine has a molecular weight of 174.25 g/mol, XLogP of 2.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-propan-2-yl-5,6-dihydro-1,7-naphthyridine is sourced from PubChem (CID 174911896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).