About sodium;benzene;2-methylpropan-2-olate
sodium;benzene;2-methylpropan-2-olate (PubChem CID 174911995) has the molecular formula C10H15NaO
and a molecular weight of 174.22 g/mol. Its IUPAC name is sodium;benzene;2-methylpropan-2-olate.
Molecular Properties
| Compound Name | sodium;benzene;2-methylpropan-2-olate |
| PubChem CID | 174911995 |
| Molecular Formula | C10H15NaO |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | sodium;benzene;2-methylpropan-2-olate |
| SMILES | CC(C)(C)[O-].[Na+].c1ccccc1 |
| InChI | InChI=1S/C6H6.C4H9O.Na/c1-2-4-6-5-3-1;1-4(2,3)5;/h1-6H;1-3H3;/q;-1;+1 |
| InChIKey | ZJXMYQFEJBUMSW-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;benzene;2-methylpropan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzene;2-methylpropan-2-olate?
The IUPAC name of sodium;benzene;2-methylpropan-2-olate (CID 174911995) is sodium;benzene;2-methylpropan-2-olate.
What is the SMILES notation for sodium;benzene;2-methylpropan-2-olate?
The canonical SMILES for sodium;benzene;2-methylpropan-2-olate is CC(C)(C)[O-].[Na+].c1ccccc1.
What is the InChIKey of sodium;benzene;2-methylpropan-2-olate?
The InChIKey is ZJXMYQFEJBUMSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C4H9O.Na/c1-2-4-6-5-3-1;1-4(2,3)5;/h1-6H;1-3H3;/q;-1;+1.
What are the key properties of sodium;benzene;2-methylpropan-2-olate?
sodium;benzene;2-methylpropan-2-olate has a molecular weight of 174.22 g/mol, XLogP of -1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzene;2-methylpropan-2-olate is sourced from PubChem (CID 174911995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).