About sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide
sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide (PubChem CID 174912002) has the molecular formula C8H16NNaO3
and a molecular weight of 197.21 g/mol. Its IUPAC name is sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide.
Molecular Properties
| Compound Name | sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide |
| PubChem CID | 174912002 |
| Molecular Formula | C8H16NNaO3 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide |
| SMILES | CCOC(=O)/C=C/CN(C)C.[Na+].[OH-] |
| InChI | InChI=1S/C8H15NO2.Na.H2O/c1-4-11-8(10)6-5-7-9(2)3;;/h5-6H,4,7H2,1-3H3;;1H2/q;+1;/p-1/b6-5+;; |
| InChIKey | YWZGPWVXVYNBIL-TXOOBNKBSA-M |
| XLogP | -2.51 |
| TPSA | 59.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide?
The IUPAC name of sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide (CID 174912002) is sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide.
What is the SMILES notation for sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide?
The canonical SMILES for sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide is CCOC(=O)/C=C/CN(C)C.[Na+].[OH-].
What is the InChIKey of sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide?
The InChIKey is YWZGPWVXVYNBIL-TXOOBNKBSA-M. The full InChI is InChI=1S/C8H15NO2.Na.H2O/c1-4-11-8(10)6-5-7-9(2)3;;/h5-6H,4,7H2,1-3H3;;1H2/q;+1;/p-1/b6-5+;;.
What are the key properties of sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide?
sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide has a molecular weight of 197.21 g/mol, XLogP of -2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethyl (E)-4-(dimethylamino)but-2-enoate;hydroxide is sourced from PubChem (CID 174912002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).