C10H7ClN2O2 — CID 174912004
methyl 3-chloro-1,8-naphthyridine-2-carboxylate (PubChem CID 174912004) has the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. Its IUPAC name is methyl 3-chloro-1,8-naphthyridine-2-carboxylate.
| Compound Name | methyl 3-chloro-1,8-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 174912004 |
| Molecular Formula | C10H7ClN2O2 |
| Molecular Weight | 222.63 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | methyl 3-chloro-1,8-naphthyridine-2-carboxylate |
| SMILES | COC(=O)c1nc2ncccc2cc1Cl |
| InChI | InChI=1S/C10H7ClN2O2/c1-15-10(14)8-7(11)5-6-3-2-4-12-9(6)13-8/h2-5H,1H3 |
| InChIKey | MWJRAYHDTJPMFQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.63 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |