About 1,2-diisocyanatoethylbenzene;hydron
1,2-diisocyanatoethylbenzene;hydron (PubChem CID 174912050) has the molecular formula C10H9N2O2+
and a molecular weight of 189.19 g/mol. Its IUPAC name is 1,2-diisocyanatoethylbenzene;hydron.
Molecular Properties
| Compound Name | 1,2-diisocyanatoethylbenzene;hydron |
| PubChem CID | 174912050 |
| Molecular Formula | C10H9N2O2+ |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 1,2-diisocyanatoethylbenzene;hydron |
| SMILES | O=C=NCC(N=C=O)c1ccccc1.[H+] |
| InChI | InChI=1S/C10H8N2O2/c13-7-11-6-10(12-8-14)9-4-2-1-3-5-9/h1-5,10H,6H2/p+1 |
| InChIKey | VDDIDKWDKHSMKA-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diisocyanatoethylbenzene;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diisocyanatoethylbenzene;hydron?
The IUPAC name of 1,2-diisocyanatoethylbenzene;hydron (CID 174912050) is 1,2-diisocyanatoethylbenzene;hydron.
What is the SMILES notation for 1,2-diisocyanatoethylbenzene;hydron?
The canonical SMILES for 1,2-diisocyanatoethylbenzene;hydron is O=C=NCC(N=C=O)c1ccccc1.[H+].
What is the InChIKey of 1,2-diisocyanatoethylbenzene;hydron?
The InChIKey is VDDIDKWDKHSMKA-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H8N2O2/c13-7-11-6-10(12-8-14)9-4-2-1-3-5-9/h1-5,10H,6H2/p+1.
What are the key properties of 1,2-diisocyanatoethylbenzene;hydron?
1,2-diisocyanatoethylbenzene;hydron has a molecular weight of 189.19 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diisocyanatoethylbenzene;hydron is sourced from PubChem (CID 174912050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).