About 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol
2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol (PubChem CID 174913122) has the molecular formula C15H25BO4
and a molecular weight of 280.17 g/mol. Its IUPAC name is 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol.
Molecular Properties
| Compound Name | 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol |
| PubChem CID | 174913122 |
| Molecular Formula | C15H25BO4 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol |
| SMILES | C=Cc1ccc(B(O)OCC(C)(C)C)cc1.OCCO |
| InChI | InChI=1S/C13H19BO2.C2H6O2/c1-5-11-6-8-12(9-7-11)14(15)16-10-13(2,3)4;3-1-2-4/h5-9,15H,1,10H2,2-4H3;3-4H,1-2H2 |
| InChIKey | XTGHIMPHEZOPQL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol?
The IUPAC name of 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol (CID 174913122) is 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol.
What is the SMILES notation for 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol?
The canonical SMILES for 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol is C=Cc1ccc(B(O)OCC(C)(C)C)cc1.OCCO.
What is the InChIKey of 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol?
The InChIKey is XTGHIMPHEZOPQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BO2.C2H6O2/c1-5-11-6-8-12(9-7-11)14(15)16-10-13(2,3)4;3-1-2-4/h5-9,15H,1,10H2,2-4H3;3-4H,1-2H2.
What are the key properties of 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol?
2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol has a molecular weight of 280.17 g/mol, XLogP of 1.05, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropoxy-(4-ethenylphenyl)borinic acid;ethane-1,2-diol is sourced from PubChem (CID 174913122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).