C46H60N6 — CID 174913167
2,4,5,6-tetrakis[4-(diethylamino)phenyl]benzene-1,3-diamine (PubChem CID 174913167) has the molecular formula C46H60N6 and a molecular weight of 697.03 g/mol. Its IUPAC name is 2,4,5,6-tetrakis[4-(diethylamino)phenyl]benzene-1,3-diamine.
| Compound Name | 2,4,5,6-tetrakis[4-(diethylamino)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 174913167 |
| Molecular Formula | C46H60N6 |
| Molecular Weight | 697.03 g/mol |
| Exact Mass | 696.49 |
| IUPAC Name | 2,4,5,6-tetrakis[4-(diethylamino)phenyl]benzene-1,3-diamine |
| SMILES | CCN(CC)c1ccc(-c2c(N)c(-c3ccc(N(CC)CC)cc3)c(-c3ccc(N(CC)CC)cc3)c(-c3ccc(N(CC)CC)cc3)c2N)cc1 |
| InChI | InChI=1S/C46H60N6/c1-9-49(10-2)37-25-17-33(18-26-37)41-42(34-19-27-38(28-20-34)50(11-3)12-4)45(47)44(36-23-31-40(32-24-36)52(15-7)16-8)46(48)43(41)35-21-29-39(30-22-35)51(13-5)14-6/h17-32H,9-16,47-48H2,1-8H3 |
| InChIKey | VLEJBMZBXCDEFB-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 65.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.03 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|