About 3,3-dibromohexanimidamide
3,3-dibromohexanimidamide (PubChem CID 174914064) has the molecular formula C6H12Br2N2
and a molecular weight of 271.98 g/mol. Its IUPAC name is 3,3-dibromohexanimidamide.
Molecular Properties
| Compound Name | 3,3-dibromohexanimidamide |
| PubChem CID | 174914064 |
| Molecular Formula | C6H12Br2N2 |
| Molecular Weight | 271.98 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | 3,3-dibromohexanimidamide |
| SMILES | [H]/N=C(\N)CC(Br)(Br)CCC |
| InChI | InChI=1S/C6H12Br2N2/c1-2-3-6(7,8)4-5(9)10/h2-4H2,1H3,(H3,9,10) |
| InChIKey | RNHYTIAVFWBRCH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.98 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dibromohexanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dibromohexanimidamide?
The IUPAC name of 3,3-dibromohexanimidamide (CID 174914064) is 3,3-dibromohexanimidamide.
What is the SMILES notation for 3,3-dibromohexanimidamide?
The canonical SMILES for 3,3-dibromohexanimidamide is [H]/N=C(\N)CC(Br)(Br)CCC.
What is the InChIKey of 3,3-dibromohexanimidamide?
The InChIKey is RNHYTIAVFWBRCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Br2N2/c1-2-3-6(7,8)4-5(9)10/h2-4H2,1H3,(H3,9,10).
What are the key properties of 3,3-dibromohexanimidamide?
3,3-dibromohexanimidamide has a molecular weight of 271.98 g/mol, XLogP of 2.60, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dibromohexanimidamide is sourced from PubChem (CID 174914064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).