About [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone
[4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone (PubChem CID 174914265) has the molecular formula C15H17F2N5O
and a molecular weight of 321.33 g/mol. Its IUPAC name is [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone.
Molecular Properties
| Compound Name | [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone |
| PubChem CID | 174914265 |
| Molecular Formula | C15H17F2N5O |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone |
| SMILES | CN(C)C1CN(C(=O)c2ccc(-n3ccnn3)cc2)CC1(F)F |
| InChI | InChI=1S/C15H17F2N5O/c1-20(2)13-9-21(10-15(13,16)17)14(23)11-3-5-12(6-4-11)22-8-7-18-19-22/h3-8,13H,9-10H2,1-2H3 |
| InChIKey | KGAFYJMOVMDKTQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone?
The IUPAC name of [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone (CID 174914265) is [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone.
What is the SMILES notation for [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone?
The canonical SMILES for [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone is CN(C)C1CN(C(=O)c2ccc(-n3ccnn3)cc2)CC1(F)F.
What is the InChIKey of [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone?
The InChIKey is KGAFYJMOVMDKTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2N5O/c1-20(2)13-9-21(10-15(13,16)17)14(23)11-3-5-12(6-4-11)22-8-7-18-19-22/h3-8,13H,9-10H2,1-2H3.
What are the key properties of [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone?
[4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone has a molecular weight of 321.33 g/mol, XLogP of 1.29, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(dimethylamino)-3,3-difluoropyrrolidin-1-yl]-[4-(triazol-1-yl)phenyl]methanone is sourced from PubChem (CID 174914265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).