About tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene
tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene (PubChem CID 174914861) has the molecular formula C4H2Cl8
and a molecular weight of 333.68 g/mol. Its IUPAC name is tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene.
Molecular Properties
| Compound Name | tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene |
| PubChem CID | 174914861 |
| Molecular Formula | C4H2Cl8 |
| Molecular Weight | 333.68 g/mol |
| Exact Mass | 329.77 |
| IUPAC Name | tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene |
| SMILES | ClC(Cl)(Cl)Cl.ClCC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C3H2Cl4.CCl4/c4-1-2(5)3(6)7;2-1(3,4)5/h1H2; |
| InChIKey | SBMFZPFULMYANM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene?
The IUPAC name of tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene (CID 174914861) is tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene.
What is the SMILES notation for tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene?
The canonical SMILES for tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene is ClC(Cl)(Cl)Cl.ClCC(Cl)=C(Cl)Cl.
What is the InChIKey of tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene?
The InChIKey is SBMFZPFULMYANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2Cl4.CCl4/c4-1-2(5)3(6)7;2-1(3,4)5/h1H2;.
What are the key properties of tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene?
tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene has a molecular weight of 333.68 g/mol, XLogP of 5.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrachloromethane;1,1,2,3-tetrachloroprop-1-ene is sourced from PubChem (CID 174914861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).