About 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione
3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 174915164) has the molecular formula C13H20NO9P
and a molecular weight of 365.28 g/mol. Its IUPAC name is 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione |
| PubChem CID | 174915164 |
| Molecular Formula | C13H20NO9P |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C(O)CCP(CCC(=O)O)CCC(=O)O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C9H15O6P.C4H5NO3/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15;6-3-1-2-4(7)5(3)8/h1-6H2,(H,10,11)(H,12,13)(H,14,15);8H,1-2H2 |
| InChIKey | HDSFEGDAQCZNRF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 169.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione?
The IUPAC name of 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione (CID 174915164) is 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione.
What is the SMILES notation for 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione?
The canonical SMILES for 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione is O=C(O)CCP(CCC(=O)O)CCC(=O)O.O=C1CCC(=O)N1O.
What is the InChIKey of 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione?
The InChIKey is HDSFEGDAQCZNRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15O6P.C4H5NO3/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15;6-3-1-2-4(7)5(3)8/h1-6H2,(H,10,11)(H,12,13)(H,14,15);8H,1-2H2.
What are the key properties of 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione?
3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione has a molecular weight of 365.28 g/mol, XLogP of 0.42, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;1-hydroxypyrrolidine-2,5-dione is sourced from PubChem (CID 174915164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).