About heptane;phenyl 4-methylbenzoate
heptane;phenyl 4-methylbenzoate (PubChem CID 174915519) has the molecular formula C21H28O2
and a molecular weight of 312.45 g/mol. Its IUPAC name is heptane;phenyl 4-methylbenzoate.
Molecular Properties
| Compound Name | heptane;phenyl 4-methylbenzoate |
| PubChem CID | 174915519 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | heptane;phenyl 4-methylbenzoate |
| SMILES | CCCCCCC.Cc1ccc(C(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C14H12O2.C7H16/c1-11-7-9-12(10-8-11)14(15)16-13-5-3-2-4-6-13;1-3-5-7-6-4-2/h2-10H,1H3;3-7H2,1-2H3 |
| InChIKey | ZSNFACJKMMUJHM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze heptane;phenyl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;phenyl 4-methylbenzoate?
The IUPAC name of heptane;phenyl 4-methylbenzoate (CID 174915519) is heptane;phenyl 4-methylbenzoate.
What is the SMILES notation for heptane;phenyl 4-methylbenzoate?
The canonical SMILES for heptane;phenyl 4-methylbenzoate is CCCCCCC.Cc1ccc(C(=O)Oc2ccccc2)cc1.
What is the InChIKey of heptane;phenyl 4-methylbenzoate?
The InChIKey is ZSNFACJKMMUJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2.C7H16/c1-11-7-9-12(10-8-11)14(15)16-13-5-3-2-4-6-13;1-3-5-7-6-4-2/h2-10H,1H3;3-7H2,1-2H3.
What are the key properties of heptane;phenyl 4-methylbenzoate?
heptane;phenyl 4-methylbenzoate has a molecular weight of 312.45 g/mol, XLogP of 6.19, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;phenyl 4-methylbenzoate is sourced from PubChem (CID 174915519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).