About 1H-azepine;1,1-dimethylsilolane
1H-azepine;1,1-dimethylsilolane (PubChem CID 174915640) has the molecular formula C12H21NSi
and a molecular weight of 207.39 g/mol. Its IUPAC name is 1H-azepine;1,1-dimethylsilolane.
Molecular Properties
| Compound Name | 1H-azepine;1,1-dimethylsilolane |
| PubChem CID | 174915640 |
| Molecular Formula | C12H21NSi |
| Molecular Weight | 207.39 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1H-azepine;1,1-dimethylsilolane |
| SMILES | C1=CC=CNC=C1.C[Si]1(C)CCCC1 |
| InChI | InChI=1S/C6H7N.C6H14Si/c1-2-4-6-7-5-3-1;1-7(2)5-3-4-6-7/h1-7H;3-6H2,1-2H3 |
| InChIKey | HQYPYYJWCCSMBF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-azepine;1,1-dimethylsilolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azepine;1,1-dimethylsilolane?
The IUPAC name of 1H-azepine;1,1-dimethylsilolane (CID 174915640) is 1H-azepine;1,1-dimethylsilolane.
What is the SMILES notation for 1H-azepine;1,1-dimethylsilolane?
The canonical SMILES for 1H-azepine;1,1-dimethylsilolane is C1=CC=CNC=C1.C[Si]1(C)CCCC1.
What is the InChIKey of 1H-azepine;1,1-dimethylsilolane?
The InChIKey is HQYPYYJWCCSMBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N.C6H14Si/c1-2-4-6-7-5-3-1;1-7(2)5-3-4-6-7/h1-7H;3-6H2,1-2H3.
What are the key properties of 1H-azepine;1,1-dimethylsilolane?
1H-azepine;1,1-dimethylsilolane has a molecular weight of 207.39 g/mol, XLogP of 3.66, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azepine;1,1-dimethylsilolane is sourced from PubChem (CID 174915640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).