About (propan-2-ylideneamino)urea;urea
(propan-2-ylideneamino)urea;urea (PubChem CID 174915685) has the molecular formula C5H13N5O2
and a molecular weight of 175.19 g/mol. Its IUPAC name is (propan-2-ylideneamino)urea;urea.
Molecular Properties
| Compound Name | (propan-2-ylideneamino)urea;urea |
| PubChem CID | 174915685 |
| Molecular Formula | C5H13N5O2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | (propan-2-ylideneamino)urea;urea |
| SMILES | CC(C)=NNC(N)=O.NC(N)=O |
| InChI | InChI=1S/C4H9N3O.CH4N2O/c1-3(2)6-7-4(5)8;2-1(3)4/h1-2H3,(H3,5,7,8);(H4,2,3,4) |
| InChIKey | VCGZBDGKWHTSGP-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino)urea;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino)urea;urea?
The IUPAC name of (propan-2-ylideneamino)urea;urea (CID 174915685) is (propan-2-ylideneamino)urea;urea.
What is the SMILES notation for (propan-2-ylideneamino)urea;urea?
The canonical SMILES for (propan-2-ylideneamino)urea;urea is CC(C)=NNC(N)=O.NC(N)=O.
What is the InChIKey of (propan-2-ylideneamino)urea;urea?
The InChIKey is VCGZBDGKWHTSGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O.CH4N2O/c1-3(2)6-7-4(5)8;2-1(3)4/h1-2H3,(H3,5,7,8);(H4,2,3,4).
What are the key properties of (propan-2-ylideneamino)urea;urea?
(propan-2-ylideneamino)urea;urea has a molecular weight of 175.19 g/mol, XLogP of -0.93, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino)urea;urea is sourced from PubChem (CID 174915685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).