C24H34N4O — CID 174915811
4-[2-[1-(3-cyclobutyl-1-phenylpyrazol-4-yl)piperidin-4-yl]ethyl]morpholine (PubChem CID 174915811) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 4-[2-[1-(3-cyclobutyl-1-phenylpyrazol-4-yl)piperidin-4-yl]ethyl]morpholine.
| Compound Name | 4-[2-[1-(3-cyclobutyl-1-phenylpyrazol-4-yl)piperidin-4-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 174915811 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 4-[2-[1-(3-cyclobutyl-1-phenylpyrazol-4-yl)piperidin-4-yl]ethyl]morpholine |
| SMILES | c1ccc(-n2cc(N3CCC(CCN4CCOCC4)CC3)c(C3CCC3)n2)cc1 |
| InChI | InChI=1S/C24H34N4O/c1-2-7-22(8-3-1)28-19-23(24(25-28)21-5-4-6-21)27-13-10-20(11-14-27)9-12-26-15-17-29-18-16-26/h1-3,7-8,19-21H,4-6,9-18H2 |
| InChIKey | IVRAZUZYCZYCCN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |