About azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone
azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone (PubChem CID 174915848) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone.
Molecular Properties
| Compound Name | azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone |
| PubChem CID | 174915848 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone |
| SMILES | CC(=O)C1C2CC(C)(C)CC21.N |
| InChI | InChI=1S/C10H16O.H3N/c1-6(11)9-7-4-10(2,3)5-8(7)9;/h7-9H,4-5H2,1-3H3;1H3 |
| InChIKey | QYLIBWZMDAURCY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone?
The IUPAC name of azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone (CID 174915848) is azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone.
What is the SMILES notation for azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone?
The canonical SMILES for azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone is CC(=O)C1C2CC(C)(C)CC21.N.
What is the InChIKey of azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone?
The InChIKey is QYLIBWZMDAURCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.H3N/c1-6(11)9-7-4-10(2,3)5-8(7)9;/h7-9H,4-5H2,1-3H3;1H3.
What are the key properties of azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone?
azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone has a molecular weight of 169.27 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-(3,3-dimethyl-6-bicyclo[3.1.0]hexanyl)ethanone is sourced from PubChem (CID 174915848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).