sodium;hydride;4-octylpiperazine-1-carbodithioic acid

C13H27N2NaS2 — CID 174915872

IUPACsodium;hydride;4-octylpiperazine-1-carbodithioic acid
SMILESCCCCCCCCN1CCN(C(=S)S)CC1.[H-].[Na+]
InChIInChI=1S/C13H26N2S2.Na.H/c1-2-3-4-5-6-7-8-14-9-11-15(12-10-14)13(16)17;;/h2-12H2,1H3,(H,16,17);;/q;+1;-1
InChIKeyGURDTKKQAIKWLH-UHFFFAOYSA-N
MW298.50 g/mol
LogP0.30
Rot. Bonds7

About sodium;hydride;4-octylpiperazine-1-carbodithioic acid

sodium;hydride;4-octylpiperazine-1-carbodithioic acid (PubChem CID 174915872) has the molecular formula C13H27N2NaS2 and a molecular weight of 298.50 g/mol. Its IUPAC name is sodium;hydride;4-octylpiperazine-1-carbodithioic acid.

Molecular Properties

Compound Namesodium;hydride;4-octylpiperazine-1-carbodithioic acid
PubChem CID174915872
Molecular FormulaC13H27N2NaS2
Molecular Weight298.50 g/mol
Exact Mass298.15
IUPAC Namesodium;hydride;4-octylpiperazine-1-carbodithioic acid
SMILESCCCCCCCCN1CCN(C(=S)S)CC1.[H-].[Na+]
InChIInChI=1S/C13H26N2S2.Na.H/c1-2-3-4-5-6-7-8-14-9-11-15(12-10-14)13(16)17;;/h2-12H2,1H3,(H,16,17);;/q;+1;-1
InChIKeyGURDTKKQAIKWLH-UHFFFAOYSA-N
XLogP0.30
TPSA6.48 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.50
LogP ≤ 50.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze sodium;hydride;4-octylpiperazine-1-carbodithioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium;hydride;4-octylpiperazine-1-carbodithioic acid?
The IUPAC name of sodium;hydride;4-octylpiperazine-1-carbodithioic acid (CID 174915872) is sodium;hydride;4-octylpiperazine-1-carbodithioic acid.
What is the SMILES notation for sodium;hydride;4-octylpiperazine-1-carbodithioic acid?
The canonical SMILES for sodium;hydride;4-octylpiperazine-1-carbodithioic acid is CCCCCCCCN1CCN(C(=S)S)CC1.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-octylpiperazine-1-carbodithioic acid?
The InChIKey is GURDTKKQAIKWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2S2.Na.H/c1-2-3-4-5-6-7-8-14-9-11-15(12-10-14)13(16)17;;/h2-12H2,1H3,(H,16,17);;/q;+1;-1.
What are the key properties of sodium;hydride;4-octylpiperazine-1-carbodithioic acid?
sodium;hydride;4-octylpiperazine-1-carbodithioic acid has a molecular weight of 298.50 g/mol, XLogP of 0.30, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-octylpiperazine-1-carbodithioic acid is sourced from PubChem (CID 174915872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).