About ethenyl(triethoxy)silane;prop-1-ene
ethenyl(triethoxy)silane;prop-1-ene (PubChem CID 174915911) has the molecular formula C11H24O3Si
and a molecular weight of 232.40 g/mol. Its IUPAC name is ethenyl(triethoxy)silane;prop-1-ene.
Molecular Properties
| Compound Name | ethenyl(triethoxy)silane;prop-1-ene |
| PubChem CID | 174915911 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | ethenyl(triethoxy)silane;prop-1-ene |
| SMILES | C=CC.C=C[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C8H18O3Si.C3H6/c1-5-9-12(8-4,10-6-2)11-7-3;1-3-2/h8H,4-7H2,1-3H3;3H,1H2,2H3 |
| InChIKey | JXGTWNSPJQMORB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(triethoxy)silane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(triethoxy)silane;prop-1-ene?
The IUPAC name of ethenyl(triethoxy)silane;prop-1-ene (CID 174915911) is ethenyl(triethoxy)silane;prop-1-ene.
What is the SMILES notation for ethenyl(triethoxy)silane;prop-1-ene?
The canonical SMILES for ethenyl(triethoxy)silane;prop-1-ene is C=CC.C=C[Si](OCC)(OCC)OCC.
What is the InChIKey of ethenyl(triethoxy)silane;prop-1-ene?
The InChIKey is JXGTWNSPJQMORB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3Si.C3H6/c1-5-9-12(8-4,10-6-2)11-7-3;1-3-2/h8H,4-7H2,1-3H3;3H,1H2,2H3.
What are the key properties of ethenyl(triethoxy)silane;prop-1-ene?
ethenyl(triethoxy)silane;prop-1-ene has a molecular weight of 232.40 g/mol, XLogP of 2.95, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(triethoxy)silane;prop-1-ene is sourced from PubChem (CID 174915911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).