About 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde
6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde (PubChem CID 174916065) has the molecular formula C8H15ClN2O5S
and a molecular weight of 286.74 g/mol. Its IUPAC name is 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde.
Molecular Properties
| Compound Name | 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde |
| PubChem CID | 174916065 |
| Molecular Formula | C8H15ClN2O5S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde |
| SMILES | NCCCCC(N=S(=O)=O)C(=O)O.O=CCCl |
| InChI | InChI=1S/C6H12N2O4S.C2H3ClO/c7-4-2-1-3-5(6(9)10)8-13(11)12;3-1-2-4/h5H,1-4,7H2,(H,9,10);2H,1H2 |
| InChIKey | DEAINHMAJZZPRY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde?
The IUPAC name of 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde (CID 174916065) is 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde.
What is the SMILES notation for 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde?
The canonical SMILES for 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde is NCCCCC(N=S(=O)=O)C(=O)O.O=CCCl.
What is the InChIKey of 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde?
The InChIKey is DEAINHMAJZZPRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O4S.C2H3ClO/c7-4-2-1-3-5(6(9)10)8-13(11)12;3-1-2-4/h5H,1-4,7H2,(H,9,10);2H,1H2.
What are the key properties of 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde?
6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde has a molecular weight of 286.74 g/mol, XLogP of 0.06, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-(sulfonylamino)hexanoic acid;2-chloroacetaldehyde is sourced from PubChem (CID 174916065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).