C29H30O2 — CID 174916141
bis(cyclopenta-1,3-diene);1,2,3,4-tetrahydrochrysen-1-ylmethanediol (PubChem CID 174916141) has the molecular formula C29H30O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);1,2,3,4-tetrahydrochrysen-1-ylmethanediol.
| Compound Name | bis(cyclopenta-1,3-diene);1,2,3,4-tetrahydrochrysen-1-ylmethanediol |
|---|---|
| PubChem CID | 174916141 |
| Molecular Formula | C29H30O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | bis(cyclopenta-1,3-diene);1,2,3,4-tetrahydrochrysen-1-ylmethanediol |
| SMILES | C1=CCC=C1.C1=CCC=C1.OC(O)C1CCCc2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C19H18O2.2C5H6/c20-19(21)18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18;2*1-2-4-5-3-1/h1-2,4-5,8-11,18-21H,3,6-7H2;2*1-4H,5H2 |
| InChIKey | BJPAFSMKIHFVQE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|