About 1-tert-butyl-3,5-dimethylbenzene;propanal
1-tert-butyl-3,5-dimethylbenzene;propanal (PubChem CID 174916459) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dimethylbenzene;propanal.
Molecular Properties
| Compound Name | 1-tert-butyl-3,5-dimethylbenzene;propanal |
| PubChem CID | 174916459 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-tert-butyl-3,5-dimethylbenzene;propanal |
| SMILES | CCC=O.Cc1cc(C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H18.C3H6O/c1-9-6-10(2)8-11(7-9)12(3,4)5;1-2-3-4/h6-8H,1-5H3;3H,2H2,1H3 |
| InChIKey | OWXXXPTZSNAVDI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3,5-dimethylbenzene;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,5-dimethylbenzene;propanal?
The IUPAC name of 1-tert-butyl-3,5-dimethylbenzene;propanal (CID 174916459) is 1-tert-butyl-3,5-dimethylbenzene;propanal.
What is the SMILES notation for 1-tert-butyl-3,5-dimethylbenzene;propanal?
The canonical SMILES for 1-tert-butyl-3,5-dimethylbenzene;propanal is CCC=O.Cc1cc(C)cc(C(C)(C)C)c1.
What is the InChIKey of 1-tert-butyl-3,5-dimethylbenzene;propanal?
The InChIKey is OWXXXPTZSNAVDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C3H6O/c1-9-6-10(2)8-11(7-9)12(3,4)5;1-2-3-4/h6-8H,1-5H3;3H,2H2,1H3.
What are the key properties of 1-tert-butyl-3,5-dimethylbenzene;propanal?
1-tert-butyl-3,5-dimethylbenzene;propanal has a molecular weight of 220.36 g/mol, XLogP of 4.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,5-dimethylbenzene;propanal is sourced from PubChem (CID 174916459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).