About 1,2-diethyl-3,5-dimethylpiperidine;hydrate
1,2-diethyl-3,5-dimethylpiperidine;hydrate (PubChem CID 174917019) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is 1,2-diethyl-3,5-dimethylpiperidine;hydrate.
Molecular Properties
| Compound Name | 1,2-diethyl-3,5-dimethylpiperidine;hydrate |
| PubChem CID | 174917019 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 1,2-diethyl-3,5-dimethylpiperidine;hydrate |
| SMILES | CCC1C(C)CC(C)CN1CC.O |
| InChI | InChI=1S/C11H23N.H2O/c1-5-11-10(4)7-9(3)8-12(11)6-2;/h9-11H,5-8H2,1-4H3;1H2 |
| InChIKey | BBMXEDGCBMRGGB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-diethyl-3,5-dimethylpiperidine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-3,5-dimethylpiperidine;hydrate?
The IUPAC name of 1,2-diethyl-3,5-dimethylpiperidine;hydrate (CID 174917019) is 1,2-diethyl-3,5-dimethylpiperidine;hydrate.
What is the SMILES notation for 1,2-diethyl-3,5-dimethylpiperidine;hydrate?
The canonical SMILES for 1,2-diethyl-3,5-dimethylpiperidine;hydrate is CCC1C(C)CC(C)CN1CC.O.
What is the InChIKey of 1,2-diethyl-3,5-dimethylpiperidine;hydrate?
The InChIKey is BBMXEDGCBMRGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N.H2O/c1-5-11-10(4)7-9(3)8-12(11)6-2;/h9-11H,5-8H2,1-4H3;1H2.
What are the key properties of 1,2-diethyl-3,5-dimethylpiperidine;hydrate?
1,2-diethyl-3,5-dimethylpiperidine;hydrate has a molecular weight of 187.33 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-3,5-dimethylpiperidine;hydrate is sourced from PubChem (CID 174917019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).