About 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol
2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol (PubChem CID 174918196) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol.
Molecular Properties
| Compound Name | 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol |
| PubChem CID | 174918196 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol |
| SMILES | Cc1ccccc1OCC1CO1.OCC1CO1 |
| InChI | InChI=1S/C10H12O2.C3H6O2/c1-8-4-2-3-5-10(8)12-7-9-6-11-9;4-1-3-2-5-3/h2-5,9H,6-7H2,1H3;3-4H,1-2H2 |
| InChIKey | BBUFEUTVXOFJRF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol?
The IUPAC name of 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol (CID 174918196) is 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol.
What is the SMILES notation for 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol?
The canonical SMILES for 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol is Cc1ccccc1OCC1CO1.OCC1CO1.
What is the InChIKey of 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol?
The InChIKey is BBUFEUTVXOFJRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C3H6O2/c1-8-4-2-3-5-10(8)12-7-9-6-11-9;4-1-3-2-5-3/h2-5,9H,6-7H2,1H3;3-4H,1-2H2.
What are the key properties of 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol?
2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol has a molecular weight of 238.28 g/mol, XLogP of 1.15, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methylphenoxy)methyl]oxirane;oxiran-2-ylmethanol is sourced from PubChem (CID 174918196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).