C40H31NO5S2 — CID 174918304
2-[(5E)-5-[[4-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 174918304) has the molecular formula C40H31NO5S2 and a molecular weight of 669.82 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[4-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 174918304 |
| Molecular Formula | C40H31NO5S2 |
| Molecular Weight | 669.82 g/mol |
| Exact Mass | 669.16 |
| IUPAC Name | 2-[(5E)-5-[[4-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1ccc(C(=C(c2ccccc2)c2ccc(-c3ccc(/C=C4/SC(=S)N(CC(=O)O)C4=O)cc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H31NO5S2/c1-45-33-20-16-31(17-21-33)38(32-18-22-34(46-2)23-19-32)37(29-6-4-3-5-7-29)30-14-12-28(13-15-30)27-10-8-26(9-11-27)24-35-39(44)41(25-36(42)43)40(47)48-35/h3-24H,25H2,1-2H3,(H,42,43)/b35-24+ |
| InChIKey | FYEBPNSYVHPFJN-JWHWKPFMSA-N |
| XLogP | 8.66 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.82 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|