About 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline
1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline (PubChem CID 174918344) has the molecular formula C23H18F3N
and a molecular weight of 365.40 g/mol. Its IUPAC name is 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline |
| PubChem CID | 174918344 |
| Molecular Formula | C23H18F3N |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline |
| SMILES | FC(F)(F)c1ccc(-c2ccc3c(c2)C(Cc2ccccc2)=NCC3)cc1 |
| InChI | InChI=1S/C23H18F3N/c24-23(25,26)20-10-8-17(9-11-20)19-7-6-18-12-13-27-22(21(18)15-19)14-16-4-2-1-3-5-16/h1-11,15H,12-14H2 |
| InChIKey | QEKLHDVUANNDDK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline?
The IUPAC name of 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline (CID 174918344) is 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline.
What is the SMILES notation for 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline?
The canonical SMILES for 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline is FC(F)(F)c1ccc(-c2ccc3c(c2)C(Cc2ccccc2)=NCC3)cc1.
What is the InChIKey of 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline?
The InChIKey is QEKLHDVUANNDDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F3N/c24-23(25,26)20-10-8-17(9-11-20)19-7-6-18-12-13-27-22(21(18)15-19)14-16-4-2-1-3-5-16/h1-11,15H,12-14H2.
What are the key properties of 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline?
1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline has a molecular weight of 365.40 g/mol, XLogP of 5.96, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-7-[4-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline is sourced from PubChem (CID 174918344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).