C33H41N3O6S — CID 174918606
4-[2-(aminomethyl)phenyl]butanoic acid;(3S)-3-amino-4-naphthalen-1-ylbutanoic acid;(3S)-3-amino-4-thiophen-2-ylbutanoic acid (PubChem CID 174918606) has the molecular formula C33H41N3O6S and a molecular weight of 607.77 g/mol. Its IUPAC name is 4-[2-(aminomethyl)phenyl]butanoic acid;(3S)-3-amino-4-naphthalen-1-ylbutanoic acid;(3S)-3-amino-4-thiophen-2-ylbutanoic acid.
| Compound Name | 4-[2-(aminomethyl)phenyl]butanoic acid;(3S)-3-amino-4-naphthalen-1-ylbutanoic acid;(3S)-3-amino-4-thiophen-2-ylbutanoic acid |
|---|---|
| PubChem CID | 174918606 |
| Molecular Formula | C33H41N3O6S |
| Molecular Weight | 607.77 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | 4-[2-(aminomethyl)phenyl]butanoic acid;(3S)-3-amino-4-naphthalen-1-ylbutanoic acid;(3S)-3-amino-4-thiophen-2-ylbutanoic acid |
| SMILES | NCc1ccccc1CCCC(=O)O.N[C@@H](CC(=O)O)Cc1cccs1.N[C@H](CC(=O)O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C14H15NO2.C11H15NO2.C8H11NO2S/c15-12(9-14(16)17)8-11-6-3-5-10-4-1-2-7-13(10)11;12-8-10-5-2-1-4-9(10)6-3-7-11(13)14;9-6(5-8(10)11)4-7-2-1-3-12-7/h1-7,12H,8-9,15H2,(H,16,17);1-2,4-5H,3,6-8,12H2,(H,13,14);1-3,6H,4-5,9H2,(H,10,11)/t12-;;6-/m0.1/s1 |
| InChIKey | MQOARGZBUJVLON-HEEWTCBLSA-N |
| XLogP | 4.83 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.77 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |