cyclohexanamine;morpholine;phosphoric acid

C10H25N2O5P — CID 174919077

IUPACcyclohexanamine;morpholine;phosphoric acid
SMILESC1COCCN1.NC1CCCCC1.O=P(O)(O)O
InChIInChI=1S/C6H13N.C4H9NO.H3O4P/c7-6-4-2-1-3-5-6;1-3-6-4-2-5-1;1-5(2,3)4/h6H,1-5,7H2;5H,1-4H2;(H3,1,2,3,4)
InChIKeyAAIJYWRGZMKGQQ-UHFFFAOYSA-N
MW284.29 g/mol
LogP-0.04
Rot. Bonds

About cyclohexanamine;morpholine;phosphoric acid

cyclohexanamine;morpholine;phosphoric acid (PubChem CID 174919077) has the molecular formula C10H25N2O5P and a molecular weight of 284.29 g/mol. Its IUPAC name is cyclohexanamine;morpholine;phosphoric acid.

Molecular Properties

Compound Namecyclohexanamine;morpholine;phosphoric acid
PubChem CID174919077
Molecular FormulaC10H25N2O5P
Molecular Weight284.29 g/mol
Exact Mass284.15
IUPAC Namecyclohexanamine;morpholine;phosphoric acid
SMILESC1COCCN1.NC1CCCCC1.O=P(O)(O)O
InChIInChI=1S/C6H13N.C4H9NO.H3O4P/c7-6-4-2-1-3-5-6;1-3-6-4-2-5-1;1-5(2,3)4/h6H,1-5,7H2;5H,1-4H2;(H3,1,2,3,4)
InChIKeyAAIJYWRGZMKGQQ-UHFFFAOYSA-N
XLogP-0.04
TPSA125.04 Ų
H-Bond Donors5
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.29
LogP ≤ 5-0.04
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze cyclohexanamine;morpholine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexanamine;morpholine;phosphoric acid?
The IUPAC name of cyclohexanamine;morpholine;phosphoric acid (CID 174919077) is cyclohexanamine;morpholine;phosphoric acid.
What is the SMILES notation for cyclohexanamine;morpholine;phosphoric acid?
The canonical SMILES for cyclohexanamine;morpholine;phosphoric acid is C1COCCN1.NC1CCCCC1.O=P(O)(O)O.
What is the InChIKey of cyclohexanamine;morpholine;phosphoric acid?
The InChIKey is AAIJYWRGZMKGQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C4H9NO.H3O4P/c7-6-4-2-1-3-5-6;1-3-6-4-2-5-1;1-5(2,3)4/h6H,1-5,7H2;5H,1-4H2;(H3,1,2,3,4).
What are the key properties of cyclohexanamine;morpholine;phosphoric acid?
cyclohexanamine;morpholine;phosphoric acid has a molecular weight of 284.29 g/mol, XLogP of -0.04, 0 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;morpholine;phosphoric acid is sourced from PubChem (CID 174919077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).