About (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate
(5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate (PubChem CID 174919089) has the molecular formula C17H20O5
and a molecular weight of 304.34 g/mol. Its IUPAC name is (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate.
Molecular Properties
| Compound Name | (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate |
| PubChem CID | 174919089 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate |
| SMILES | C=C(C(=O)Oc1cc(=O)c(O)co1)C1(C)CCCC(C)=C1C |
| InChI | InChI=1S/C17H20O5/c1-10-6-5-7-17(4,11(10)2)12(3)16(20)22-15-8-13(18)14(19)9-21-15/h8-9,19H,3,5-7H2,1-2,4H3 |
| InChIKey | GTNVKNSNVKCBNM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate?
The IUPAC name of (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate (CID 174919089) is (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate.
What is the SMILES notation for (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate?
The canonical SMILES for (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate is C=C(C(=O)Oc1cc(=O)c(O)co1)C1(C)CCCC(C)=C1C.
What is the InChIKey of (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate?
The InChIKey is GTNVKNSNVKCBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O5/c1-10-6-5-7-17(4,11(10)2)12(3)16(20)22-15-8-13(18)14(19)9-21-15/h8-9,19H,3,5-7H2,1-2,4H3.
What are the key properties of (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate?
(5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate has a molecular weight of 304.34 g/mol, XLogP of 3.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-4-oxopyran-2-yl) 2-(1,2,3-trimethylcyclohex-2-en-1-yl)prop-2-enoate is sourced from PubChem (CID 174919089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).