C20H19N3O3S2 — CID 17491914
N-(2-methyl-3-nitrophenyl)-2-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide (PubChem CID 17491914) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-(2-methyl-3-nitrophenyl)-2-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide.
| Compound Name | N-(2-methyl-3-nitrophenyl)-2-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
|---|---|
| PubChem CID | 17491914 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-(2-methyl-3-nitrophenyl)-2-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
| SMILES | Cc1c(NC(=O)CN2CCc3sccc3C2c2cccs2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19N3O3S2/c1-13-15(4-2-5-16(13)23(25)26)21-19(24)12-22-9-7-17-14(8-11-28-17)20(22)18-6-3-10-27-18/h2-6,8,10-11,20H,7,9,12H2,1H3,(H,21,24) |
| InChIKey | JULQJGNSZNXRAL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|