About 3-piperazin-1-yl-1,5-naphthyridine
3-piperazin-1-yl-1,5-naphthyridine (PubChem CID 174919144) has the molecular formula C12H14N4
and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-piperazin-1-yl-1,5-naphthyridine.
Molecular Properties
| Compound Name | 3-piperazin-1-yl-1,5-naphthyridine |
| PubChem CID | 174919144 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-piperazin-1-yl-1,5-naphthyridine |
| SMILES | c1cnc2cc(N3CCNCC3)cnc2c1 |
| InChI | InChI=1S/C12H14N4/c1-2-11-12(14-3-1)8-10(9-15-11)16-6-4-13-5-7-16/h1-3,8-9,13H,4-7H2 |
| InChIKey | ARYPBMQXFNLUSP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-piperazin-1-yl-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperazin-1-yl-1,5-naphthyridine?
The IUPAC name of 3-piperazin-1-yl-1,5-naphthyridine (CID 174919144) is 3-piperazin-1-yl-1,5-naphthyridine.
What is the SMILES notation for 3-piperazin-1-yl-1,5-naphthyridine?
The canonical SMILES for 3-piperazin-1-yl-1,5-naphthyridine is c1cnc2cc(N3CCNCC3)cnc2c1.
What is the InChIKey of 3-piperazin-1-yl-1,5-naphthyridine?
The InChIKey is ARYPBMQXFNLUSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4/c1-2-11-12(14-3-1)8-10(9-15-11)16-6-4-13-5-7-16/h1-3,8-9,13H,4-7H2.
What are the key properties of 3-piperazin-1-yl-1,5-naphthyridine?
3-piperazin-1-yl-1,5-naphthyridine has a molecular weight of 214.27 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperazin-1-yl-1,5-naphthyridine is sourced from PubChem (CID 174919144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).