About propane;bis(trichlorosilane)
propane;bis(trichlorosilane) (PubChem CID 174919689) has the molecular formula C3H10Cl6Si2
and a molecular weight of 315.00 g/mol. Its IUPAC name is propane;bis(trichlorosilane).
Molecular Properties
| Compound Name | propane;bis(trichlorosilane) |
| PubChem CID | 174919689 |
| Molecular Formula | C3H10Cl6Si2 |
| Molecular Weight | 315.00 g/mol |
| Exact Mass | 311.85 |
| IUPAC Name | propane;bis(trichlorosilane) |
| SMILES | CCC.Cl[SiH](Cl)Cl.Cl[SiH](Cl)Cl |
| InChI | InChI=1S/C3H8.2Cl3HSi/c1-3-2;2*1-4(2)3/h3H2,1-2H3;2*4H |
| InChIKey | SSHZBDZGTBVTHO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.00 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze propane;bis(trichlorosilane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;bis(trichlorosilane)?
The IUPAC name of propane;bis(trichlorosilane) (CID 174919689) is propane;bis(trichlorosilane).
What is the SMILES notation for propane;bis(trichlorosilane)?
The canonical SMILES for propane;bis(trichlorosilane) is CCC.Cl[SiH](Cl)Cl.Cl[SiH](Cl)Cl.
What is the InChIKey of propane;bis(trichlorosilane)?
The InChIKey is SSHZBDZGTBVTHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8.2Cl3HSi/c1-3-2;2*1-4(2)3/h3H2,1-2H3;2*4H.
What are the key properties of propane;bis(trichlorosilane)?
propane;bis(trichlorosilane) has a molecular weight of 315.00 g/mol, XLogP of 4.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propane;bis(trichlorosilane) is sourced from PubChem (CID 174919689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).