C6H8Cl2N3NaO3 — CID 174919713
sodium;3-(1,5-dichloro-1,3,5-triazinan-2-yl)-2,3-dioxopropanal;hydride (PubChem CID 174919713) has the molecular formula C6H8Cl2N3NaO3 and a molecular weight of 264.04 g/mol. Its IUPAC name is sodium;3-(1,5-dichloro-1,3,5-triazinan-2-yl)-2,3-dioxopropanal;hydride.
| Compound Name | sodium;3-(1,5-dichloro-1,3,5-triazinan-2-yl)-2,3-dioxopropanal;hydride |
|---|---|
| PubChem CID | 174919713 |
| Molecular Formula | C6H8Cl2N3NaO3 |
| Molecular Weight | 264.04 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | sodium;3-(1,5-dichloro-1,3,5-triazinan-2-yl)-2,3-dioxopropanal;hydride |
| SMILES | O=CC(=O)C(=O)C1NCN(Cl)CN1Cl.[H-].[Na+] |
| InChI | InChI=1S/C6H7Cl2N3O3.Na.H/c7-10-2-9-6(11(8)3-10)5(14)4(13)1-12;;/h1,6,9H,2-3H2;;/q;+1;-1 |
| InChIKey | JXGBGDNDRSKGGD-UHFFFAOYSA-N |
| XLogP | -3.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.04 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|