C14H28N2O2 — CID 174921359
1-N,3-N-dimethyl-2,3-bis(oxiran-2-ylmethyl)hexane-1,3-diamine (PubChem CID 174921359) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-2,3-bis(oxiran-2-ylmethyl)hexane-1,3-diamine.
| Compound Name | 1-N,3-N-dimethyl-2,3-bis(oxiran-2-ylmethyl)hexane-1,3-diamine |
|---|---|
| PubChem CID | 174921359 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-N,3-N-dimethyl-2,3-bis(oxiran-2-ylmethyl)hexane-1,3-diamine |
| SMILES | CCCC(CC1CO1)(NC)C(CNC)CC1CO1 |
| InChI | InChI=1S/C14H28N2O2/c1-4-5-14(16-3,7-13-10-18-13)11(8-15-2)6-12-9-17-12/h11-13,15-16H,4-10H2,1-3H3 |
| InChIKey | HMSJLZKFZDBZPN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|