C19H31F3O — CID 174921420
1,2,4-trimethyl-5-[8-(2,2,2-trifluoroethoxy)octyl]cyclohexa-1,4-diene (PubChem CID 174921420) has the molecular formula C19H31F3O and a molecular weight of 332.45 g/mol. Its IUPAC name is 1,2,4-trimethyl-5-[8-(2,2,2-trifluoroethoxy)octyl]cyclohexa-1,4-diene.
| Compound Name | 1,2,4-trimethyl-5-[8-(2,2,2-trifluoroethoxy)octyl]cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 174921420 |
| Molecular Formula | C19H31F3O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 1,2,4-trimethyl-5-[8-(2,2,2-trifluoroethoxy)octyl]cyclohexa-1,4-diene |
| SMILES | CC1=C(C)CC(CCCCCCCCOCC(F)(F)F)=C(C)C1 |
| InChI | InChI=1S/C19H31F3O/c1-15-12-17(3)18(13-16(15)2)10-8-6-4-5-7-9-11-23-14-19(20,21)22/h4-14H2,1-3H3 |
| InChIKey | DHKHLANOPJKCEK-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|